 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NCCC[NH+]1CCCCC1CC)c1cc(nc2c1cccc2)-c1cccnc1 |
| InChI: | InChI=1/C25H30N4O/c1-2-20-10-5-6-15-29(20)16-8-14-27-25(30)22-17-24(19-9-7-13-26-18-19)28-23-12-4-3-11-21(22)23/h3-4,7,9,11-13,17-18,20H,2,5-6,8,10,14-16H2,1H3,(H,27,30)/p+1/t20-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=68.2217 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 403.55 g/mol | logS: -4.61499 | SlogP: 3.2641 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0295987 | Sterimol/B1: 2.32392 | Sterimol/B2: 4.82701 | Sterimol/B3: 5.39787 | |||
| Sterimol/B4: 8.72884 | Sterimol/L: 18.325 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 737.383 | Positive charged surface: 524.031 | Negative charged surface: 204.884 | Volume: 421.625 | |||
| Hydrophobic surface: 627.894 | Hydrophilic surface: 109.489 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
