Type: Neutral
Formula: C25H27NO3S
SMILES: |
S(=O)(=O)(N(Cc1ccccc1)C1CC(CCC1O)C=C)c1cc2c(cc1)cccc2 |
InChI: |
InChI=1/C25H27NO3S/c1-2-19-12-15-25(27)24(16-19)26(18-20-8-4-3-5-9-20)30(28,29)23-14-13-21-10-6-7-11-22(21)17-23/h2-11,13-14,17,19,24-25,27H,1,12,15-16,18H2/t19-,24+,25+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 421.561 g/mol | logS: -6.37544 | SlogP: 5.0127 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.179601 | Sterimol/B1: 2.43606 | Sterimol/B2: 3.21807 | Sterimol/B3: 5.5708 |
Sterimol/B4: 10.8682 | Sterimol/L: 14.7394 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 632.436 | Positive charged surface: 345.868 | Negative charged surface: 276.754 | Volume: 404.25 |
Hydrophobic surface: 516.532 | Hydrophilic surface: 115.904 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |