Type: Neutral
Formula: C18H25N3O4S2
SMILES: |
S1C2C(N=C1Nc1ccc(cc1)C(=O)NCCCOC(C)C)CS(=O)(=O)C2 |
InChI: |
InChI=1/C18H25N3O4S2/c1-12(2)25-9-3-8-19-17(22)13-4-6-14(7-5-13)20-18-21-15-10-27(23,24)11-16(15)26-18/h4-7,12,15-16H,3,8-11H2,1-2H3,(H,19,22)(H,20,21)/t15-,16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 411.547 g/mol | logS: -4.28339 | SlogP: 1.9118 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0215171 | Sterimol/B1: 2.37147 | Sterimol/B2: 4.58228 | Sterimol/B3: 4.73627 |
Sterimol/B4: 6.32708 | Sterimol/L: 21.498 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 708.112 | Positive charged surface: 437.69 | Negative charged surface: 270.422 | Volume: 371.5 |
Hydrophobic surface: 467.165 | Hydrophilic surface: 240.947 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |