 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC1(N(c2cc(C)c(cc2)C)C(=O)Nc2c1cccc2)C(=O)NCC1[NH+](CCC1)CC |
| InChI: | InChI=1/C24H30N4O3/c1-4-27-13-7-8-19(27)15-25-22(29)24(31)20-9-5-6-10-21(20)26-23(30)28(24)18-12-11-16(2)17(3)14-18/h5-6,9-12,14,19,31H,4,7-8,13,15H2,1-3H3,(H,25,29)(H,26,30)/p+1/t19-,24+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=83.519 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 423.537 g/mol | logS: -4.99538 | SlogP: 1.99554 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.2082 | Sterimol/B1: 2.17063 | Sterimol/B2: 2.89672 | Sterimol/B3: 5.91757 | |||
| Sterimol/B4: 11.6492 | Sterimol/L: 14.4364 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 697.677 | Positive charged surface: 472.449 | Negative charged surface: 225.228 | Volume: 423.125 | |||
| Hydrophobic surface: 554.768 | Hydrophilic surface: 142.909 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
