 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC1(N(c2ccccc2)C(=O)Nc2c1cccc2)C(=O)NCC1[NH+](CCC1)CC |
| InChI: | InChI=1/C22H26N4O3/c1-2-25-14-8-11-17(25)15-23-20(27)22(29)18-12-6-7-13-19(18)24-21(28)26(22)16-9-4-3-5-10-16/h3-7,9-10,12-13,17,29H,2,8,11,14-15H2,1H3,(H,23,27)(H,24,28)/p+1/t17-,22-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=81.0794 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 395.483 g/mol | logS: -4.04754 | SlogP: 1.3787 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.162737 | Sterimol/B1: 2.57706 | Sterimol/B2: 3.11533 | Sterimol/B3: 4.93888 | |||
| Sterimol/B4: 9.48073 | Sterimol/L: 14.7445 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 622.315 | Positive charged surface: 419.56 | Negative charged surface: 202.755 | Volume: 389.125 | |||
| Hydrophobic surface: 475.784 | Hydrophilic surface: 146.531 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
