 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(CC(=O)NCCC[NH+]1C(CCCC1C)C)C1=CC(=O)N(c2c1cccc2)CC |
| InChI: | InChI=1/C23H33N3O2S/c1-4-25-20-12-6-5-11-19(20)21(15-23(25)28)29-16-22(27)24-13-8-14-26-17(2)9-7-10-18(26)3/h5-6,11-12,15,17-18H,4,7-10,13-14,16H2,1-3H3,(H,24,27)/p+1/t17-,18-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=54.7248 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 416.61 g/mol | logS: -5.15025 | SlogP: 2.4793 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0617618 | Sterimol/B1: 2.04991 | Sterimol/B2: 4.02707 | Sterimol/B3: 6.27294 | |||
| Sterimol/B4: 6.75764 | Sterimol/L: 20.2818 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 732.777 | Positive charged surface: 511.812 | Negative charged surface: 220.964 | Volume: 428.75 | |||
| Hydrophobic surface: 562.033 | Hydrophilic surface: 170.744 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
