Type: Neutral
Formula: C20H25N3O3S2
SMILES: |
S1C2C(N=C1Nc1ccc(cc1)C(=O)NCCC=1CCCCC=1)CS(=O)(=O)C2 |
InChI: |
InChI=1/C20H25N3O3S2/c24-19(21-11-10-14-4-2-1-3-5-14)15-6-8-16(9-7-15)22-20-23-17-12-28(25,26)13-18(17)27-20/h4,6-9,17-18H,1-3,5,10-13H2,(H,21,24)(H,22,23)/t17-,18+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 419.57 g/mol | logS: -5.25191 | SlogP: 2.9872 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0319058 | Sterimol/B1: 2.36725 | Sterimol/B2: 2.98178 | Sterimol/B3: 4.38915 |
Sterimol/B4: 7.73136 | Sterimol/L: 21.4686 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 692.693 | Positive charged surface: 433.968 | Negative charged surface: 258.725 | Volume: 379.625 |
Hydrophobic surface: 494.843 | Hydrophilic surface: 197.85 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |