Type: Neutral
Formula: C21H22F3N3OS
SMILES: |
S(CC(=O)NC(C)c1ccccc1)C=1NC(CC(N=1)C(F)(F)F)c1ccccc1 |
InChI: |
InChI=1/C21H22F3N3OS/c1-14(15-8-4-2-5-9-15)25-19(28)13-29-20-26-17(16-10-6-3-7-11-16)12-18(27-20)21(22,23)24/h2-11,14,17-18H,12-13H2,1H3,(H,25,28)(H,26,27)/t14-,17+,18+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 421.487 g/mol | logS: -6.3749 | SlogP: 5.2294 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0965304 | Sterimol/B1: 2.8011 | Sterimol/B2: 2.92852 | Sterimol/B3: 6.28491 |
Sterimol/B4: 7.51324 | Sterimol/L: 18.062 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 685.302 | Positive charged surface: 352.233 | Negative charged surface: 333.068 | Volume: 378 |
Hydrophobic surface: 471.522 | Hydrophilic surface: 213.78 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |