Type: Neutral
Formula: C16H21N3O3S2
SMILES: |
S1C2C(N=C1Nc1ccc(cc1)C(=O)NC(CC)C)CS(=O)(=O)C2 |
InChI: |
InChI=1/C16H21N3O3S2/c1-3-10(2)17-15(20)11-4-6-12(7-5-11)18-16-19-13-8-24(21,22)9-14(13)23-16/h4-7,10,13-14H,3,8-9H2,1-2H3,(H,17,20)(H,18,19)/t10-,13-,14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 367.494 g/mol | logS: -4.14075 | SlogP: 1.8952 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0380021 | Sterimol/B1: 2.4591 | Sterimol/B2: 2.552 | Sterimol/B3: 4.39068 |
Sterimol/B4: 7.74686 | Sterimol/L: 18.0068 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 612.335 | Positive charged surface: 355.717 | Negative charged surface: 256.617 | Volume: 326.25 |
Hydrophobic surface: 390.355 | Hydrophilic surface: 221.98 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |