Type: Neutral
Formula: C21H38N2O2
SMILES: |
O=C(NC(C(C)C)C(=O)NC1CCCC(C)C1C)C1CCC(CC1)C |
InChI: |
InChI=1/C21H38N2O2/c1-13(2)19(23-20(24)17-11-9-14(3)10-12-17)21(25)22-18-8-6-7-15(4)16(18)5/h13-19H,6-12H2,1-5H3,(H,22,25)(H,23,24)/t14-,15-,16-,17+,18+,19+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 350.547 g/mol | logS: -5.2243 | SlogP: 3.8944 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0657349 | Sterimol/B1: 3.19011 | Sterimol/B2: 3.35008 | Sterimol/B3: 3.80625 |
Sterimol/B4: 5.93946 | Sterimol/L: 18.0943 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 624.849 | Positive charged surface: 471.12 | Negative charged surface: 153.729 | Volume: 379.625 |
Hydrophobic surface: 497.176 | Hydrophilic surface: 127.673 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |