 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Fc1cccc(F)c1N1C(O)(c2c(NC1=O)cccc2)C(=O)NCCCN1CCCC1 |
| InChI: | InChI=1/C22H24F2N4O3/c23-16-8-5-9-17(24)19(16)28-21(30)26-18-10-2-1-7-15(18)22(28,31)20(29)25-11-6-14-27-12-3-4-13-27/h1-2,5,7-10,31H,3-4,6,11-14H2,(H,25,29)(H,26,30)/t22-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=88.6555 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 430.455 g/mol | logS: -4.53645 | SlogP: 3.0756 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.120235 | Sterimol/B1: 2.90087 | Sterimol/B2: 3.26245 | Sterimol/B3: 5.32418 | |||
| Sterimol/B4: 11.3824 | Sterimol/L: 15.9574 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 669.875 | Positive charged surface: 427.569 | Negative charged surface: 242.306 | Volume: 387.625 | |||
| Hydrophobic surface: 561.443 | Hydrophilic surface: 108.432 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
