Type: Neutral
Formula: C16H20N4O4S2
SMILES: |
S1C2C(N=C1Nc1ccc(cc1)C(=O)NCCNC(=O)C)CS(=O)(=O)C2 |
InChI: |
InChI=1/C16H20N4O4S2/c1-10(21)17-6-7-18-15(22)11-2-4-12(5-3-11)19-16-20-13-8-26(23,24)9-14(13)25-16/h2-5,13-14H,6-9H2,1H3,(H,17,21)(H,18,22)(H,19,20)/t13-,14-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 396.492 g/mol | logS: -3.46449 | SlogP: 0.2328 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0257074 | Sterimol/B1: 3.47021 | Sterimol/B2: 3.57907 | Sterimol/B3: 4.10288 |
Sterimol/B4: 4.68566 | Sterimol/L: 22.6133 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 656.548 | Positive charged surface: 383.008 | Negative charged surface: 273.54 | Volume: 339.25 |
Hydrophobic surface: 406.692 | Hydrophilic surface: 249.856 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |