 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(CCc2ccc(cc2)C)C(CC1)(C(=O)NC1CCC(CC1)C)C |
| InChI: | InChI=1/C22H32N2O2/c1-16-4-8-18(9-5-16)13-15-24-20(25)12-14-22(24,3)21(26)23-19-10-6-17(2)7-11-19/h4-5,8-9,17,19H,6-7,10-15H2,1-3H3,(H,23,26)/t17-,19-,22-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=65.6209 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 356.51 g/mol | logS: -4.67908 | SlogP: 3.61349 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0879612 | Sterimol/B1: 2.15983 | Sterimol/B2: 3.92696 | Sterimol/B3: 4.71844 | |||
| Sterimol/B4: 8.85818 | Sterimol/L: 18.5271 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 655.829 | Positive charged surface: 430.962 | Negative charged surface: 224.867 | Volume: 377.625 | |||
| Hydrophobic surface: 565.767 | Hydrophilic surface: 90.062 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.