Type: Neutral
Formula: C18H18ClN3O2
SMILES: |
Clc1cc(C)c(OCCCC(=O)Nc2[nH]c3c(n2)cccc3)cc1 |
InChI: |
InChI=1/C18H18ClN3O2/c1-12-11-13(19)8-9-16(12)24-10-4-7-17(23)22-18-20-14-5-2-3-6-15(14)21-18/h2-3,5-6,8-9,11H,4,7,10H2,1H3,(H2,20,21,22,23) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 343.814 g/mol | logS: -5.43158 | SlogP: 4.32242 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.00533929 | Sterimol/B1: 2.06454 | Sterimol/B2: 2.37809 | Sterimol/B3: 2.51206 |
Sterimol/B4: 6.65884 | Sterimol/L: 21.8051 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 620.059 | Positive charged surface: 354.841 | Negative charged surface: 265.218 | Volume: 319.875 |
Hydrophobic surface: 522.106 | Hydrophilic surface: 97.953 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |