Type: Neutral
Formula: C14H18N2O8
SMILES: |
O1C(CO)C(O)C(O)C(NC(=O)C)C1Oc1cc([N+](=O)[O-])ccc1 |
InChI: |
InChI=1/C14H18N2O8/c1-7(18)15-11-13(20)12(19)10(6-17)24-14(11)23-9-4-2-3-8(5-9)16(21)22/h2-5,10-14,17,19-20H,6H2,1H3,(H,15,18)/t10-,11-,12-,13-,14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 342.304 g/mol | logS: -1.97001 | SlogP: -1.0827 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0847174 | Sterimol/B1: 2.09549 | Sterimol/B2: 3.06321 | Sterimol/B3: 3.65267 |
Sterimol/B4: 10.7303 | Sterimol/L: 14.5988 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 552.064 | Positive charged surface: 324.066 | Negative charged surface: 227.998 | Volume: 288.625 |
Hydrophobic surface: 302.407 | Hydrophilic surface: 249.657 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |