Type: Neutral
Formula: C10H11BrN4O6
SMILES: |
Brc1nc2c(n1C1OC(CO)C(O)C1O)NC(=O)NC2=O |
InChI: |
InChI=1/C10H11BrN4O6/c11-9-12-3-6(13-10(20)14-7(3)19)15(9)8-5(18)4(17)2(1-16)21-8/h2,4-5,8,16-18H,1H2,(H2,13,14,19,20)/t2-,4-,5+,8-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 363.124 g/mol | logS: -2.15703 | SlogP: -1.3721 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.123319 | Sterimol/B1: 3.10208 | Sterimol/B2: 4.12509 | Sterimol/B3: 4.67492 |
Sterimol/B4: 4.95711 | Sterimol/L: 13.3568 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 475.845 | Positive charged surface: 263.831 | Negative charged surface: 212.014 | Volume: 250.5 |
Hydrophobic surface: 161.711 | Hydrophilic surface: 314.134 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |