 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Clc1cc(Cl)ccc1C1Nc2c(cc(S(=O)([O-])=[NH])cc2)C2C1CC=C2 |
| InChI: | InChI=1/C18H15Cl2N2O2S/c19-10-4-6-14(16(20)8-10)18-13-3-1-2-12(13)15-9-11(25(21,23)24)5-7-17(15)22-18/h1-2,4-9,12-13,18,22H,3H2,(H-,21,23,24)/q-1/t12-,13+,18+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=61.073 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 394.302 g/mol | logS: -5.34016 | SlogP: 4.887 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.161497 | Sterimol/B1: 3.00897 | Sterimol/B2: 3.86911 | Sterimol/B3: 5.25016 | |||
| Sterimol/B4: 7.40564 | Sterimol/L: 15.4284 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 577.366 | Positive charged surface: 237.643 | Negative charged surface: 339.723 | Volume: 330.75 | |||
| Hydrophobic surface: 424.293 | Hydrophilic surface: 153.073 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 0 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
