Type: Neutral
Formula: C19H28N2O2S
SMILES: |
s1cccc1CN1C(CCC1=O)(C(=O)NC1CCCCCCC1)C |
InChI: |
InChI=1/C19H28N2O2S/c1-19(18(23)20-15-8-5-3-2-4-6-9-15)12-11-17(22)21(19)14-16-10-7-13-24-16/h7,10,13,15H,2-6,8-9,11-12,14H2,1H3,(H,20,23)/t19-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 348.511 g/mol | logS: -4.46558 | SlogP: 4.1247 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.120999 | Sterimol/B1: 2.44518 | Sterimol/B2: 4.45442 | Sterimol/B3: 4.9399 |
Sterimol/B4: 6.10767 | Sterimol/L: 16.2448 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 577.039 | Positive charged surface: 364.134 | Negative charged surface: 212.904 | Volume: 343.375 |
Hydrophobic surface: 511.039 | Hydrophilic surface: 66 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |