Type: Neutral
Formula: C19H23N3O3
SMILES: |
O(CCC)c1cc(ccc1)C(=O)NCCCNC(=O)c1ccncc1 |
InChI: |
InChI=1/C19H23N3O3/c1-2-13-25-17-6-3-5-16(14-17)19(24)22-10-4-9-21-18(23)15-7-11-20-12-8-15/h3,5-8,11-12,14H,2,4,9-10,13H2,1H3,(H,21,23)(H,22,24) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 341.411 g/mol | logS: -2.99447 | SlogP: 2.4203 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.00509934 | Sterimol/B1: 2.37596 | Sterimol/B2: 2.37606 | Sterimol/B3: 4.30972 |
Sterimol/B4: 4.44338 | Sterimol/L: 24.2667 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 669.072 | Positive charged surface: 465.519 | Negative charged surface: 203.553 | Volume: 339.75 |
Hydrophobic surface: 536.354 | Hydrophilic surface: 132.718 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |