Type: Neutral
Formula: C17H25N3O
| SMILES: |
O=C(NCCCn1ccnc1)C12CC(CC1)C(C)(C)C2=C |
| InChI: |
InChI=1/C17H25N3O/c1-13-16(2,3)14-5-6-17(13,11-14)15(21)19-7-4-9-20-10-8-18-12-20/h8,10,12,14H,1,4-7,9,11H2,2-3H3,(H,19,21)/t14-,17-/m1/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 287.407 g/mol | logS: -3.53979 | SlogP: 3.0383 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.093221 | Sterimol/B1: 2.62128 | Sterimol/B2: 2.83958 | Sterimol/B3: 4.79089 |
| Sterimol/B4: 5.35842 | Sterimol/L: 16.2916 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 553.112 | Positive charged surface: 403.294 | Negative charged surface: 149.817 | Volume: 304.375 |
| Hydrophobic surface: 425.01 | Hydrophilic surface: 128.102 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 2 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |