 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(Cc1ccccc1)C(=O)NC(CC(C)C)C(=O)[O-])c1ccccc1 |
| InChI: | InChI=1/C22H26N2O4/c1-15(2)13-19(22(27)28)24-21(26)18(14-16-9-5-3-6-10-16)23-20(25)17-11-7-4-8-12-17/h3-12,15,18-19H,13-14H2,1-2H3,(H,23,25)(H,24,26)(H,27,28)/p-1/t18-,19-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=81.905 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 381.452 g/mol | logS: -5.34866 | SlogP: 1.30847 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0826422 | Sterimol/B1: 2.43155 | Sterimol/B2: 5.24162 | Sterimol/B3: 5.41861 | |||
| Sterimol/B4: 8.22181 | Sterimol/L: 14.5785 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 669.274 | Positive charged surface: 382.302 | Negative charged surface: 286.972 | Volume: 380.875 | |||
| Hydrophobic surface: 507.918 | Hydrophilic surface: 161.356 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
