Type: Neutral
Formula: C18H19N5O3S
SMILES: |
s1c2c(nc1N\C(=N/C(=O)CN1C(=O)C3C(CCCC3)C1=O)\N)cccc2 |
InChI: |
InChI=1/C18H19N5O3S/c19-17(22-18-20-12-7-3-4-8-13(12)27-18)21-14(24)9-23-15(25)10-5-1-2-6-11(10)16(23)26/h3-4,7-8,10-11H,1-2,5-6,9H2,(H3,19,20,21,22,24)/t10-,11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 385.448 g/mol | logS: -5.00162 | SlogP: 1.7247 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0384408 | Sterimol/B1: 3.56884 | Sterimol/B2: 3.77055 | Sterimol/B3: 4.37381 |
Sterimol/B4: 6.58952 | Sterimol/L: 19.5283 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 619.437 | Positive charged surface: 399.958 | Negative charged surface: 219.479 | Volume: 336.875 |
Hydrophobic surface: 402.016 | Hydrophilic surface: 217.421 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |