 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Clc1ccc(cc1)C1Nc2c(cc(cc2)C(=O)N2CCCCC2C)C2C1CC=C2 |
| InChI: | InChI=1/C25H27ClN2O/c1-16-5-2-3-14-28(16)25(29)18-10-13-23-22(15-18)20-6-4-7-21(20)24(27-23)17-8-11-19(26)12-9-17/h4,6,8-13,15-16,20-21,24,27H,2-3,5,7,14H2,1H3/t16-,20+,21+,24+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=174.081 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 406.957 g/mol | logS: -5.47637 | SlogP: 6.2766 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.126252 | Sterimol/B1: 2.00968 | Sterimol/B2: 4.76556 | Sterimol/B3: 5.86552 | |||
| Sterimol/B4: 6.747 | Sterimol/L: 17.3387 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 650.818 | Positive charged surface: 398.252 | Negative charged surface: 252.566 | Volume: 391.875 | |||
| Hydrophobic surface: 556.314 | Hydrophilic surface: 94.504 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.