 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccc(cc1)CC([NH3+])C(=O)NC(C(=O)NCC(=O)NCC(=O)N)C |
| InChI: | InChI=1/C16H23N5O5/c1-9(15(25)20-8-14(24)19-7-13(18)23)21-16(26)12(17)6-10-2-4-11(22)5-3-10/h2-5,9,12,22H,6-8,17H2,1H3,(H2,18,23)(H,19,24)(H,20,25)(H,21,26)/p+1/t9-,12-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=59.3524 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 366.398 g/mol | logS: -1.84841 | SlogP: -3.23243 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0331968 | Sterimol/B1: 2.28453 | Sterimol/B2: 2.9814 | Sterimol/B3: 4.57405 | |||
| Sterimol/B4: 7.25806 | Sterimol/L: 22.0281 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 670.019 | Positive charged surface: 452.073 | Negative charged surface: 217.946 | Volume: 341.625 | |||
| Hydrophobic surface: 308.715 | Hydrophilic surface: 361.304 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
