Type: Neutral
Formula: C20H22N6O2S2
SMILES: |
s1cc(nc1NC(=O)CSc1nnc(n1CC=C)C(NC(=O)c1ccccc1)C)C |
InChI: |
InChI=1/C20H22N6O2S2/c1-4-10-26-17(14(3)22-18(28)15-8-6-5-7-9-15)24-25-20(26)30-12-16(27)23-19-21-13(2)11-29-19/h4-9,11,14H,1,10,12H2,2-3H3,(H,22,28)(H,21,23,27)/t14-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 442.568 g/mol | logS: -5.85101 | SlogP: 3.81272 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0267088 | Sterimol/B1: 3.63584 | Sterimol/B2: 3.90014 | Sterimol/B3: 4.10305 |
Sterimol/B4: 9.15223 | Sterimol/L: 22.9993 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 746.899 | Positive charged surface: 413.913 | Negative charged surface: 332.986 | Volume: 404.75 |
Hydrophobic surface: 508.201 | Hydrophilic surface: 238.698 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |