Type: Neutral
Formula: C16H25NO3
SMILES: |
OC(=O)CC12CC3(CC(C1)CC(C3)C2)C(NC(=O)C)C |
InChI: |
InChI=1/C16H25NO3/c1-10(17-11(2)18)16-6-12-3-13(7-16)5-15(4-12,9-16)8-14(19)20/h10,12-13H,3-9H2,1-2H3,(H,17,18)(H,19,20)/t10-,12-,13+,15-,16-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 279.38 g/mol | logS: -3.25427 | SlogP: 2.5723 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.146957 | Sterimol/B1: 2.14511 | Sterimol/B2: 3.32213 | Sterimol/B3: 4.37474 |
Sterimol/B4: 6.576 | Sterimol/L: 15.4202 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 484.499 | Positive charged surface: 344.99 | Negative charged surface: 139.509 | Volume: 273.75 |
Hydrophobic surface: 344.038 | Hydrophilic surface: 140.461 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |