Type: Neutral
Formula: C19H21NO2
SMILES: |
O1CCCC1C(NC(=O)c1ccc(cc1)-c1ccccc1)C |
InChI: |
InChI=1/C19H21NO2/c1-14(18-8-5-13-22-18)20-19(21)17-11-9-16(10-12-17)15-6-3-2-4-7-15/h2-4,6-7,9-12,14,18H,5,8,13H2,1H3,(H,20,21)/t14-,18+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 295.382 g/mol | logS: -4.97962 | SlogP: 3.6509 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0224615 | Sterimol/B1: 2.13552 | Sterimol/B2: 3.27313 | Sterimol/B3: 4.62872 |
Sterimol/B4: 5.63681 | Sterimol/L: 18.5919 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 570.913 | Positive charged surface: 343.127 | Negative charged surface: 215.05 | Volume: 302 |
Hydrophobic surface: 510.036 | Hydrophilic surface: 60.877 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |