Type: Neutral
Formula: C19H24N2O2S2
SMILES: |
s1c2CC(CCc2c(C(=O)N)c1NC(=O)c1sccc1)C(CC)(C)C |
InChI: |
InChI=1/C19H24N2O2S2/c1-4-19(2,3)11-7-8-12-14(10-11)25-18(15(12)16(20)22)21-17(23)13-6-5-9-24-13/h5-6,9,11H,4,7-8,10H2,1-3H3,(H2,20,22)(H,21,23)/t11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 376.545 g/mol | logS: -7.04358 | SlogP: 4.70184 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0354783 | Sterimol/B1: 2.50727 | Sterimol/B2: 3.03061 | Sterimol/B3: 3.77482 |
Sterimol/B4: 7.70548 | Sterimol/L: 18.6225 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 614.944 | Positive charged surface: 348.96 | Negative charged surface: 265.984 | Volume: 350.25 |
Hydrophobic surface: 432.245 | Hydrophilic surface: 182.699 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |