Type: Neutral
Formula: C20H26N2O2S2
SMILES: |
s1c2CC(CCc2c(C(=O)NCC)c1NC(=O)c1sccc1)C(C)(C)C |
InChI: |
InChI=1/C20H26N2O2S2/c1-5-21-18(24)16-13-9-8-12(20(2,3)4)11-15(13)26-19(16)22-17(23)14-7-6-10-25-14/h6-7,10,12H,5,8-9,11H2,1-4H3,(H,21,24)(H,22,23)/t12-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 390.572 g/mol | logS: -6.74958 | SlogP: 4.96254 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0474028 | Sterimol/B1: 2.4235 | Sterimol/B2: 2.58245 | Sterimol/B3: 4.71853 |
Sterimol/B4: 10.3185 | Sterimol/L: 18.1645 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 656.603 | Positive charged surface: 385.445 | Negative charged surface: 271.158 | Volume: 373.75 |
Hydrophobic surface: 512.897 | Hydrophilic surface: 143.706 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |