Type: Neutral
Formula: C20H22N2O3
SMILES: |
O1CCCC1CNC(=O)c1ccc(NC(=O)c2ccccc2C)cc1 |
InChI: |
InChI=1/C20H22N2O3/c1-14-5-2-3-7-18(14)20(24)22-16-10-8-15(9-11-16)19(23)21-13-17-6-4-12-25-17/h2-3,5,7-11,17H,4,6,12-13H2,1H3,(H,21,23)(H,22,24)/t17-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 338.407 g/mol | logS: -4.66994 | SlogP: 3.15612 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0121741 | Sterimol/B1: 2.37652 | Sterimol/B2: 2.53592 | Sterimol/B3: 3.18381 |
Sterimol/B4: 7.80666 | Sterimol/L: 20.1189 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 621.322 | Positive charged surface: 406.518 | Negative charged surface: 214.804 | Volume: 335.75 |
Hydrophobic surface: 541.101 | Hydrophilic surface: 80.221 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |