Type: Neutral
Formula: C18H27N3O2
| SMILES: |
O=C(NC(C(C)C)C(=O)NCc1cccnc1)C1CCCCC1 |
| InChI: |
InChI=1/C18H27N3O2/c1-13(2)16(21-17(22)15-8-4-3-5-9-15)18(23)20-12-14-7-6-10-19-11-14/h6-7,10-11,13,15-16H,3-5,8-9,12H2,1-2H3,(H,20,23)(H,21,22)/t16-/m1/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 317.433 g/mol | logS: -3.03071 | SlogP: 2.6853 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.0753693 | Sterimol/B1: 2.31219 | Sterimol/B2: 2.67988 | Sterimol/B3: 4.87746 |
| Sterimol/B4: 7.07355 | Sterimol/L: 18.0342 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 601.149 | Positive charged surface: 445.551 | Negative charged surface: 155.598 | Volume: 326.375 |
| Hydrophobic surface: 490.712 | Hydrophilic surface: 110.437 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 1 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |