 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(C2OC(OC2C1N1C=CC(=NC1=O)NC(=O)c1ccccc1)(C)C)CO |
| InChI: | InChI=1/C19H21N3O6/c1-19(2)27-14-12(10-23)26-17(15(14)28-19)22-9-8-13(21-18(22)25)20-16(24)11-6-4-3-5-7-11/h3-9,12,14-15,17,23H,10H2,1-2H3,(H,20,21,24,25)/t12-,14+,15-,17+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=113.291 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 387.392 g/mol | logS: -3.67121 | SlogP: 1.0015 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0563014 | Sterimol/B1: 2.40897 | Sterimol/B2: 2.86918 | Sterimol/B3: 5.3999 | |||
| Sterimol/B4: 7.29433 | Sterimol/L: 18.3767 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 624.272 | Positive charged surface: 381.371 | Negative charged surface: 242.902 | Volume: 344.375 | |||
| Hydrophobic surface: 413.98 | Hydrophilic surface: 210.292 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.