Type: Neutral
Formula: C19H23N3OS
SMILES: |
S(CC(O)Cn1c2CCCCc2c2c1cccc2)c1nccn1C |
InChI: |
InChI=1/C19H23N3OS/c1-21-11-10-20-19(21)24-13-14(23)12-22-17-8-4-2-6-15(17)16-7-3-5-9-18(16)22/h2,4,6,8,10-11,14,23H,3,5,7,9,12-13H2,1H3/t14-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 341.479 g/mol | logS: -4.37077 | SlogP: 4.03234 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0691379 | Sterimol/B1: 1.99755 | Sterimol/B2: 5.31462 | Sterimol/B3: 6.08416 |
Sterimol/B4: 6.58998 | Sterimol/L: 16.763 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 603.839 | Positive charged surface: 438.373 | Negative charged surface: 160.005 | Volume: 337.125 |
Hydrophobic surface: 511.512 | Hydrophilic surface: 92.327 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |