Type: Neutral
Formula: C11H16N2O7
SMILES: |
O1C(CO)C(O)C(O)C(O)C1N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C11H16N2O7/c1-4-2-13(11(19)12-9(4)18)10-8(17)7(16)6(15)5(3-14)20-10/h2,5-8,10,14-17H,3H2,1H3,(H,12,18,19)/t5-,6+,7+,8+,10+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 288.256 g/mol | logS: 0.31394 | SlogP: -2.7581 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.164334 | Sterimol/B1: 2.87911 | Sterimol/B2: 3.89007 | Sterimol/B3: 4.54914 |
Sterimol/B4: 5.63738 | Sterimol/L: 11.6293 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 448.603 | Positive charged surface: 311.267 | Negative charged surface: 137.336 | Volume: 236.25 |
Hydrophobic surface: 189.852 | Hydrophilic surface: 258.751 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |