Type: Neutral
Formula: C11H17N3O6S
SMILES: |
S(=O)(=O)(NC1CC(OC1CO)N1C=C(C)C(=O)NC1=O)C |
InChI: |
InChI=1/C11H17N3O6S/c1-6-4-14(11(17)12-10(6)16)9-3-7(8(5-15)20-9)13-21(2,18)19/h4,7-9,13,15H,3,5H2,1-2H3,(H,12,16,17)/t7-,8-,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 319.338 g/mol | logS: -0.30391 | SlogP: -1.5329 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.130002 | Sterimol/B1: 3.57908 | Sterimol/B2: 3.92261 | Sterimol/B3: 4.98318 |
Sterimol/B4: 5.8656 | Sterimol/L: 14.3188 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 508.119 | Positive charged surface: 301.829 | Negative charged surface: 206.29 | Volume: 261.75 |
Hydrophobic surface: 259.203 | Hydrophilic surface: 248.916 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |