Type: Neutral
Formula: C17H22N2O4
SMILES: |
O1CC(NC(Cc2[nH]c3c(c2)cccc3)C(O)=O)C(O)(CC1)C |
InChI: |
InChI=1/C17H22N2O4/c1-17(22)6-7-23-10-15(17)19-14(16(20)21)9-12-8-11-4-2-3-5-13(11)18-12/h2-5,8,14-15,18-19,22H,6-7,9-10H2,1H3,(H,20,21)/t14-,15-,17-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 318.373 g/mol | logS: -2.24343 | SlogP: 1.29307 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.1209 | Sterimol/B1: 2.17402 | Sterimol/B2: 3.11867 | Sterimol/B3: 4.89911 |
Sterimol/B4: 7.94686 | Sterimol/L: 13.9645 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 532.309 | Positive charged surface: 361.486 | Negative charged surface: 167.749 | Volume: 303.375 |
Hydrophobic surface: 374.92 | Hydrophilic surface: 157.389 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |