Type: Neutral
Formula: C13H16N4O5
SMILES: |
O1C(C2OC(OC2C1n1c2N=CNC(=O)c2nc1)(C)C)CO |
InChI: |
InChI=1/C13H16N4O5/c1-13(2)21-8-6(3-18)20-12(9(8)22-13)17-5-16-7-10(17)14-4-15-11(7)19/h4-6,8-9,12,18H,3H2,1-2H3,(H,14,15,19)/t6-,8-,9-,12+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 308.294 g/mol | logS: -2.16431 | SlogP: -0.2084 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.207028 | Sterimol/B1: 2.09975 | Sterimol/B2: 3.05391 | Sterimol/B3: 4.50565 |
Sterimol/B4: 8.15987 | Sterimol/L: 12.8901 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 501.395 | Positive charged surface: 353.699 | Negative charged surface: 147.696 | Volume: 262.875 |
Hydrophobic surface: 245.431 | Hydrophilic surface: 255.964 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |