 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1NC2NC(=O)NC2N1C(CCC)C(O)=O |
| InChI: | InChI=1/C9H14N4O4/c1-2-3-4(7(14)15)13-6-5(11-9(13)17)10-8(16)12-6/h4-6H,2-3H2,1H3,(H,11,17)(H,14,15)(H2,10,12,16)/t4-,5+,6-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-13.7346 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 242.235 g/mol | logS: -0.61131 | SlogP: -0.7701 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.234532 | Sterimol/B1: 2.48359 | Sterimol/B2: 3.23019 | Sterimol/B3: 3.84169 | |||
| Sterimol/B4: 7.46099 | Sterimol/L: 10.0094 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 415.261 | Positive charged surface: 281.322 | Negative charged surface: 133.938 | Volume: 207.625 | |||
| Hydrophobic surface: 145.452 | Hydrophilic surface: 269.809 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
