Type: Neutral
Formula: C17H17N3O5S
SMILES: |
s1cccc1C(=O)Nc1cc([N+](=O)[O-])ccc1C(=O)NCC1OCCC1 |
InChI: |
InChI=1/C17H17N3O5S/c21-16(18-10-12-3-1-7-25-12)13-6-5-11(20(23)24)9-14(13)19-17(22)15-4-2-8-26-15/h2,4-6,8-9,12H,1,3,7,10H2,(H,18,21)(H,19,22)/t12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 375.405 g/mol | logS: -4.79292 | SlogP: 2.8174 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0229533 | Sterimol/B1: 2.967 | Sterimol/B2: 3.19972 | Sterimol/B3: 3.37395 |
Sterimol/B4: 11.1545 | Sterimol/L: 16.6559 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 619.727 | Positive charged surface: 336.221 | Negative charged surface: 283.506 | Volume: 322.5 |
Hydrophobic surface: 463.653 | Hydrophilic surface: 156.074 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |