Type: Neutral
Formula: C15H28N4O5
SMILES: |
OC(C(N)C(=O)N1CCCC1C(=O)NC(CCCCN)C(O)=O)C |
InChI: |
InChI=1/C15H28N4O5/c1-9(20)12(17)14(22)19-8-4-6-11(19)13(21)18-10(15(23)24)5-2-3-7-16/h9-12,20H,2-8,16-17H2,1H3,(H,18,21)(H,23,24)/t9-,10+,11+,12+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 344.412 g/mol | logS: -0.49061 | SlogP: -1.6161 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.145738 | Sterimol/B1: 3.57257 | Sterimol/B2: 3.71092 | Sterimol/B3: 6.07956 |
Sterimol/B4: 6.09989 | Sterimol/L: 16.9859 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 621.111 | Positive charged surface: 470.002 | Negative charged surface: 151.109 | Volume: 328.25 |
Hydrophobic surface: 328.475 | Hydrophilic surface: 292.636 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |