 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(Cc1[nH+]c[nH]c1)C(=O)[O-])C(NC(=O)C[NH3+])CCCC[NH3+] |
| InChI: | InChI=1/C14H24N6O4/c15-4-2-1-3-10(19-12(21)6-16)13(22)20-11(14(23)24)5-9-7-17-8-18-9/h7-8,10-11H,1-6,15-16H2,(H,17,18)(H,19,21)(H,20,22)(H,23,24)/p+2/t10-,11-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-12.5164 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 342.4 g/mol | logS: -0.69334 | SlogP: -5.25513 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0549602 | Sterimol/B1: 2.49921 | Sterimol/B2: 3.05956 | Sterimol/B3: 4.12887 | |||
| Sterimol/B4: 9.04548 | Sterimol/L: 18.0138 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 611.666 | Positive charged surface: 528.31 | Negative charged surface: 83.3561 | Volume: 320.875 | |||
| Hydrophobic surface: 259.242 | Hydrophilic surface: 352.424 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 4 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
