Type: Neutral
Formula: C16H19N3O3
SMILES: |
OC(=O)C(NC(=O)C1NCCC1)Cc1c2c([nH]c1)cccc2 |
InChI: |
InChI=1/C16H19N3O3/c20-15(13-6-3-7-17-13)19-14(16(21)22)8-10-9-18-12-5-2-1-4-11(10)12/h1-2,4-5,9,13-14,17-18H,3,6-8H2,(H,19,20)(H,21,22)/t13-,14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 301.346 g/mol | logS: -2.19754 | SlogP: 1.03177 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.149401 | Sterimol/B1: 2.23685 | Sterimol/B2: 3.3363 | Sterimol/B3: 5.03708 |
Sterimol/B4: 9.3498 | Sterimol/L: 12.7412 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 532.034 | Positive charged surface: 350.436 | Negative charged surface: 178.801 | Volume: 288.25 |
Hydrophobic surface: 347.97 | Hydrophilic surface: 184.064 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |