 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(C(CC)C)C(=O)[O-] |
| InChI: | InChI=1/C23H28N2O5/c1-3-16(2)20(22(27)28)25-21(26)19(14-17-10-6-4-7-11-17)24-23(29)30-15-18-12-8-5-9-13-18/h4-13,16,19-20H,3,14-15H2,1-2H3,(H,24,29)(H,25,26)(H,27,28)/p-1/t16-,19-,20-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=56.624 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 411.478 g/mol | logS: -5.11203 | SlogP: 2.07127 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0721701 | Sterimol/B1: 2.72206 | Sterimol/B2: 3.54161 | Sterimol/B3: 3.6572 | |||
| Sterimol/B4: 11.4441 | Sterimol/L: 16.8805 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 730.399 | Positive charged surface: 430.655 | Negative charged surface: 299.743 | Volume: 409.125 | |||
| Hydrophobic surface: 551.918 | Hydrophilic surface: 178.481 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
