 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(CCC(NC(=O)C(NC(OCc1ccccc1)=O)C(CC)C)C(=O)[O-])C |
| InChI: | InChI=1/C19H28N2O5S/c1-4-13(2)16(17(22)20-15(18(23)24)10-11-27-3)21-19(25)26-12-14-8-6-5-7-9-14/h5-9,13,15-16H,4,10-12H2,1-3H3,(H,20,22)(H,21,25)(H,23,24)/p-1/t13-,15-,16-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=38.6282 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 395.5 g/mol | logS: -4.47631 | SlogP: 1.5817 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0975546 | Sterimol/B1: 2.26342 | Sterimol/B2: 2.5451 | Sterimol/B3: 5.57832 | |||
| Sterimol/B4: 12.2262 | Sterimol/L: 17.6029 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 720.812 | Positive charged surface: 422.515 | Negative charged surface: 298.296 | Volume: 383.75 | |||
| Hydrophobic surface: 494.021 | Hydrophilic surface: 226.791 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
