 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(Nc1cc2c(cc1)cccc2)C([NH3+])CCCNC(=[NH2+])N |
| InChI: | InChI=1/C16H21N5O/c17-14(6-3-9-20-16(18)19)15(22)21-13-8-7-11-4-1-2-5-12(11)10-13/h1-2,4-5,7-8,10,14H,3,6,9,17H2,(H,21,22)(H4,18,19,20)/p+2/t14-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-8.82106 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 301.394 g/mol | logS: -3.83151 | SlogP: -1.1676 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0387879 | Sterimol/B1: 2.96796 | Sterimol/B2: 3.18791 | Sterimol/B3: 3.38648 | |||
| Sterimol/B4: 6.63335 | Sterimol/L: 19.3515 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 598.99 | Positive charged surface: 423.47 | Negative charged surface: 164.965 | Volume: 306 | |||
| Hydrophobic surface: 354.875 | Hydrophilic surface: 244.115 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 4 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
