Type: Neutral
Formula: C11H21N3O5S
SMILES: |
S(CCC(N)C(=O)NC(C(=O)NC(C(O)=O)CO)C)C |
InChI: |
InChI=1/C11H21N3O5S/c1-6(9(16)14-8(5-15)11(18)19)13-10(17)7(12)3-4-20-2/h6-8,15H,3-5,12H2,1-2H3,(H,13,17)(H,14,16)(H,18,19)/t6-,7-,8-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 307.371 g/mol | logS: -0.9412 | SlogP: -1.8668 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0469767 | Sterimol/B1: 2.28672 | Sterimol/B2: 2.57343 | Sterimol/B3: 4.19429 |
Sterimol/B4: 7.37096 | Sterimol/L: 17.6265 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 570.301 | Positive charged surface: 370.238 | Negative charged surface: 200.063 | Volume: 279.25 |
Hydrophobic surface: 261.004 | Hydrophilic surface: 309.297 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |