 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccc(cc1)CC([NH3+])C(=O)NC(CCCNC(=[NH2+])N)C(=O)[O-] |
| InChI: | InChI=1/C15H23N5O4/c16-11(8-9-3-5-10(21)6-4-9)13(22)20-12(14(23)24)2-1-7-19-15(17)18/h3-6,11-12,21H,1-2,7-8,16H2,(H,20,22)(H,23,24)(H4,17,18,19)/p+1/t11-,12-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-23.4906 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 338.388 g/mol | logS: -1.85348 | SlogP: -4.77653 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0593761 | Sterimol/B1: 3.01256 | Sterimol/B2: 4.5315 | Sterimol/B3: 4.75771 | |||
| Sterimol/B4: 6.11359 | Sterimol/L: 18.8617 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 625.515 | Positive charged surface: 433.213 | Negative charged surface: 192.302 | Volume: 322.125 | |||
| Hydrophobic surface: 267.807 | Hydrophilic surface: 357.708 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 4 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
