Type: Neutral
Formula: C17H23N3O3S2
SMILES: |
S1C2C(N=C1Nc1cc(ccc1C)C(=O)NC(CC)C)CS(=O)(=O)C2 |
InChI: |
InChI=1/C17H23N3O3S2/c1-4-11(3)18-16(21)12-6-5-10(2)13(7-12)19-17-20-14-8-25(22,23)9-15(14)24-17/h5-7,11,14-15H,4,8-9H2,1-3H3,(H,18,21)(H,19,20)/t11-,14+,15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 381.521 g/mol | logS: -4.30122 | SlogP: 2.20362 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.085989 | Sterimol/B1: 2.22132 | Sterimol/B2: 3.51333 | Sterimol/B3: 6.03851 |
Sterimol/B4: 7.87414 | Sterimol/L: 16.4088 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 632.723 | Positive charged surface: 381.957 | Negative charged surface: 250.766 | Volume: 346 |
Hydrophobic surface: 429.173 | Hydrophilic surface: 203.55 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |