Type: Neutral
Formula: C17H24N2O3S
SMILES: |
S(CCC(NC(=O)NC1CCCc2c1cccc2)C(OC)=O)C |
InChI: |
InChI=1/C17H24N2O3S/c1-22-16(20)15(10-11-23-2)19-17(21)18-14-9-5-7-12-6-3-4-8-13(12)14/h3-4,6,8,14-15H,5,7,9-11H2,1-2H3,(H2,18,19,21)/t14-,15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 336.456 g/mol | logS: -3.87491 | SlogP: 2.75337 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0996788 | Sterimol/B1: 2.1149 | Sterimol/B2: 2.838 | Sterimol/B3: 4.6626 |
Sterimol/B4: 10.3932 | Sterimol/L: 14.5828 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 618.472 | Positive charged surface: 419.942 | Negative charged surface: 198.531 | Volume: 326.375 |
Hydrophobic surface: 501.61 | Hydrophilic surface: 116.862 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |