 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C2C(C3OC34C(C2)(CCCC4C)C)C(C[NH+]2CCN(CC2)c2cc(ccc2)C)C1=O |
| InChI: | InChI=1/C26H36N2O3/c1-17-6-4-8-19(14-17)28-12-10-27(11-13-28)16-20-22-21(30-24(20)29)15-25(3)9-5-7-18(2)26(25)23(22)31-26/h4,6,8,14,18,20-23H,5,7,9-13,15-16H2,1-3H3/p+1/t18-,20+,21+,22+,23+,25+,26+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=113.568 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 425.593 g/mol | logS: -4.5897 | SlogP: 2.22532 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.0531108 | Sterimol/B1: 2.98952 | Sterimol/B2: 3.04585 | Sterimol/B3: 5.56799 | |||
| Sterimol/B4: 5.77906 | Sterimol/L: 20.6968 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 705.435 | Positive charged surface: 523.684 | Negative charged surface: 181.75 | Volume: 436.625 | |||
| Hydrophobic surface: 602.89 | Hydrophilic surface: 102.545 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 0 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 7 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
